C23H44O6 — CID 145368477
(6E,8E,13S)-1,2,15-trimethoxy-6,10,14-trimethylheptadeca-6,8-diene-1,11,13-triol (PubChem CID 145368477) has the molecular formula C23H44O6 and a molecular weight of 416.60 g/mol. Its IUPAC name is (6E,8E,13S)-1,2,15-trimethoxy-6,10,14-trimethylheptadeca-6,8-diene-1,11,13-triol.
| Compound Name | (6E,8E,13S)-1,2,15-trimethoxy-6,10,14-trimethylheptadeca-6,8-diene-1,11,13-triol |
|---|---|
| PubChem CID | 145368477 |
| Molecular Formula | C23H44O6 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | (6E,8E,13S)-1,2,15-trimethoxy-6,10,14-trimethylheptadeca-6,8-diene-1,11,13-triol |
| SMILES | CCC(OC)C(C)[C@@H](O)CC(O)C(C)/C=C/C=C(\C)CCCC(OC)C(O)OC |
| InChI | InChI=1S/C23H44O6/c1-8-21(27-5)18(4)20(25)15-19(24)17(3)13-9-11-16(2)12-10-14-22(28-6)23(26)29-7/h9,11,13,17-26H,8,10,12,14-15H2,1-7H3/b13-9+,16-11+/t17?,18?,19?,20-,21?,22?,23?/m0/s1 |
| InChIKey | JOHDAGCWIFAREK-JQCCCFLMSA-N |
| XLogP | 3.45 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|