C24H44O6 — CID 145368442
(3E,5E)-8,10,11-trimethoxy-1-[2-(3-methoxypentan-2-yl)cyclopropyl]-6-methylundeca-3,5-diene-1,11-diol (PubChem CID 145368442) has the molecular formula C24H44O6 and a molecular weight of 428.61 g/mol. Its IUPAC name is (3E,5E)-8,10,11-trimethoxy-1-[2-(3-methoxypentan-2-yl)cyclopropyl]-6-methylundeca-3,5-diene-1,11-diol.
| Compound Name | (3E,5E)-8,10,11-trimethoxy-1-[2-(3-methoxypentan-2-yl)cyclopropyl]-6-methylundeca-3,5-diene-1,11-diol |
|---|---|
| PubChem CID | 145368442 |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | (3E,5E)-8,10,11-trimethoxy-1-[2-(3-methoxypentan-2-yl)cyclopropyl]-6-methylundeca-3,5-diene-1,11-diol |
| SMILES | CCC(OC)C(C)C1CC1C(O)C/C=C/C=C(\C)CC(CC(OC)C(O)OC)OC |
| InChI | InChI=1S/C24H44O6/c1-8-22(28-5)17(3)19-15-20(19)21(25)12-10-9-11-16(2)13-18(27-4)14-23(29-6)24(26)30-7/h9-11,17-26H,8,12-15H2,1-7H3/b10-9+,16-11+ |
| InChIKey | CHQWNGQPMRQSKW-AKYRVGECSA-N |
| XLogP | 3.71 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|