C25H50O5 — CID 145368408
ethane;(6E,8E)-1,4,15-trimethoxy-6,10,14-trimethylheptadeca-6,8-diene-1,11-diol (PubChem CID 145368408) has the molecular formula C25H50O5 and a molecular weight of 430.67 g/mol. Its IUPAC name is ethane;(6E,8E)-1,4,15-trimethoxy-6,10,14-trimethylheptadeca-6,8-diene-1,11-diol.
| Compound Name | ethane;(6E,8E)-1,4,15-trimethoxy-6,10,14-trimethylheptadeca-6,8-diene-1,11-diol |
|---|---|
| PubChem CID | 145368408 |
| Molecular Formula | C25H50O5 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.37 |
| IUPAC Name | ethane;(6E,8E)-1,4,15-trimethoxy-6,10,14-trimethylheptadeca-6,8-diene-1,11-diol |
| SMILES | CC.CCC(OC)C(C)CCC(O)C(C)/C=C/C=C(\C)CC(CCC(O)OC)OC |
| InChI | InChI=1S/C23H44O5.C2H6/c1-8-22(27-6)19(4)12-14-21(24)18(3)11-9-10-17(2)16-20(26-5)13-15-23(25)28-7;1-2/h9-11,18-25H,8,12-16H2,1-7H3;1-2H3/b11-9+,17-10+; |
| InChIKey | CQVLIXUCSWEWQD-FFTBIALNSA-N |
| XLogP | 5.50 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|