C14H15F2NOS — CID 130425057
(E)-N-(3,4-difluoro-5-methylphenyl)-N-methyl-2-methylidene-4-sulfanylpent-3-enamide (PubChem CID 130425057) has the molecular formula C14H15F2NOS and a molecular weight of 283.34 g/mol. Its IUPAC name is (E)-N-(3,4-difluoro-5-methylphenyl)-N-methyl-2-methylidene-4-sulfanylpent-3-enamide.
| Compound Name | (E)-N-(3,4-difluoro-5-methylphenyl)-N-methyl-2-methylidene-4-sulfanylpent-3-enamide |
|---|---|
| PubChem CID | 130425057 |
| Molecular Formula | C14H15F2NOS |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (E)-N-(3,4-difluoro-5-methylphenyl)-N-methyl-2-methylidene-4-sulfanylpent-3-enamide |
| SMILES | C=C(/C=C(\C)S)C(=O)N(C)c1cc(C)c(F)c(F)c1 |
| InChI | InChI=1S/C14H15F2NOS/c1-8-6-11(7-12(15)13(8)16)17(4)14(18)9(2)5-10(3)19/h5-7,19H,2H2,1,3-4H3/b10-5+ |
| InChIKey | ITIDLSZMQGJCNC-BJMVGYQFSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|