C11H11F2N — CID 146522190
N-buta-1,3-dien-2-yl-3,4-difluoro-N-methylaniline (PubChem CID 146522190) has the molecular formula C11H11F2N and a molecular weight of 195.21 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-3,4-difluoro-N-methylaniline.
| Compound Name | N-buta-1,3-dien-2-yl-3,4-difluoro-N-methylaniline |
|---|---|
| PubChem CID | 146522190 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | N-buta-1,3-dien-2-yl-3,4-difluoro-N-methylaniline |
| SMILES | C=CC(=C)N(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H11F2N/c1-4-8(2)14(3)9-5-6-10(12)11(13)7-9/h4-7H,1-2H2,3H3 |
| InChIKey | XYVTTWCDSBAMLP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|