C26H25FN4O2 — CID 130426938
1-[(3R)-3-[[3-fluoro-5-(4-phenoxybenzenecarboximidoyl)-4-pyridinyl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 130426938) has the molecular formula C26H25FN4O2 and a molecular weight of 444.51 g/mol. Its IUPAC name is 1-[(3R)-3-[[3-fluoro-5-(4-phenoxybenzenecarboximidoyl)-4-pyridinyl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[3-fluoro-5-(4-phenoxybenzenecarboximidoyl)-4-pyridinyl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130426938 |
| Molecular Formula | C26H25FN4O2 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1-[(3R)-3-[[3-fluoro-5-(4-phenoxybenzenecarboximidoyl)-4-pyridinyl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1cncc(F)c1N[C@@H]1CCCN(C(=O)C=C)C1 |
| InChI | InChI=1S/C26H25FN4O2/c1-2-24(32)31-14-6-7-19(17-31)30-26-22(15-29-16-23(26)27)25(28)18-10-12-21(13-11-18)33-20-8-4-3-5-9-20/h2-5,8-13,15-16,19,28H,1,6-7,14,17H2,(H,29,30)/b28-25+/t19-/m1/s1 |
| InChIKey | YLIAIFOJWQFLNK-MUAPEBMPSA-N |
| XLogP | 5.02 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|