C26H27N5O2 — CID 130426838
1-[(3R)-3-[[5-(3-methyl-4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 130426838) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 1-[(3R)-3-[[5-(3-methyl-4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[5-(3-methyl-4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130426838 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-[(3R)-3-[[5-(3-methyl-4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C(\c1ccc(Oc2ccccc2)c(C)c1)c1cncnc1N[C@@H]1CCCN(C(=O)C=C)C1 |
| InChI | InChI=1S/C26H27N5O2/c1-3-24(32)31-13-7-8-20(16-31)30-26-22(15-28-17-29-26)25(27)19-11-12-23(18(2)14-19)33-21-9-5-4-6-10-21/h3-6,9-12,14-15,17,20,27H,1,7-8,13,16H2,2H3,(H,28,29,30)/b27-25+/t20-/m1/s1 |
| InChIKey | IRXTVIJXHKLBFZ-XMTYCTGGSA-N |
| XLogP | 4.58 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|