C31H35N7O2 — CID 130426472
4-(4-methylpiperazin-1-yl)-1-[4-[[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]but-2-yn-1-one (PubChem CID 130426472) has the molecular formula C31H35N7O2 and a molecular weight of 537.67 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-1-[4-[[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]but-2-yn-1-one.
| Compound Name | 4-(4-methylpiperazin-1-yl)-1-[4-[[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 130426472 |
| Molecular Formula | C31H35N7O2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-1-[4-[[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]but-2-yn-1-one |
| SMILES | [H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1cncnc1NC1CCN(C(=O)C#CCN2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C31H35N7O2/c1-36-18-20-37(21-19-36)15-5-8-29(39)38-16-13-25(14-17-38)35-31-28(22-33-23-34-31)30(32)24-9-11-27(12-10-24)40-26-6-3-2-4-7-26/h2-4,6-7,9-12,22-23,25,32H,13-21H2,1H3,(H,33,34,35)/b32-30+ |
| InChIKey | KOXGKASUXZFHDS-NHQGMKOOSA-N |
| XLogP | 3.34 |
| TPSA | 97.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|