C29H32N6O2 — CID 145368642
(E)-4-(dimethylamino)-1-[2-[[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]-5-azaspiro[2.4]heptan-5-yl]but-2-en-1-one (PubChem CID 145368642) has the molecular formula C29H32N6O2 and a molecular weight of 496.62 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[2-[[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]-5-azaspiro[2.4]heptan-5-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[2-[[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]-5-azaspiro[2.4]heptan-5-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 145368642 |
| Molecular Formula | C29H32N6O2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[2-[[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]-5-azaspiro[2.4]heptan-5-yl]but-2-en-1-one |
| SMILES | [H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1cncnc1NC1CC12CCN(C(=O)/C=C/CN(C)C)C2 |
| InChI | InChI=1S/C29H32N6O2/c1-34(2)15-6-9-26(36)35-16-14-29(19-35)17-25(29)33-28-24(18-31-20-32-28)27(30)21-10-12-23(13-11-21)37-22-7-4-3-5-8-22/h3-13,18,20,25,30H,14-17,19H2,1-2H3,(H,31,32,33)/b9-6+,30-27+ |
| InChIKey | HNKYREHARDPAKV-NRSFGPNISA-N |
| XLogP | 4.21 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|