C27H28N5O2+ — CID 163607342
(1-pent-2-ynoylpiperidin-4-yl)-[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]azanium (PubChem CID 163607342) has the molecular formula C27H28N5O2+ and a molecular weight of 454.55 g/mol. Its IUPAC name is (1-pent-2-ynoylpiperidin-4-yl)-[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]azanium.
| Compound Name | (1-pent-2-ynoylpiperidin-4-yl)-[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]azanium |
|---|---|
| PubChem CID | 163607342 |
| Molecular Formula | C27H28N5O2+ |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | (1-pent-2-ynoylpiperidin-4-yl)-[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]azanium |
| SMILES | [H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1cncnc1[NH2+]C1CCN(C(=O)C#CCC)CC1 |
| InChI | InChI=1S/C27H27N5O2/c1-2-3-9-25(33)32-16-14-21(15-17-32)31-27-24(18-29-19-30-27)26(28)20-10-12-23(13-11-20)34-22-7-5-4-6-8-22/h4-8,10-13,18-19,21,28H,2,14-17H2,1H3,(H,29,30,31)/p+1/b28-26+ |
| InChIKey | HCXHIYFKHCGHEO-BYCLXTJYSA-O |
| XLogP | 3.28 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|