C25H22N5O2- — CID 163759598
[(2R)-1-but-2-ynoylazetidin-2-yl]methyl-[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]azanide (PubChem CID 163759598) has the molecular formula C25H22N5O2- and a molecular weight of 424.48 g/mol. Its IUPAC name is [(2R)-1-but-2-ynoylazetidin-2-yl]methyl-[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]azanide.
| Compound Name | [(2R)-1-but-2-ynoylazetidin-2-yl]methyl-[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]azanide |
|---|---|
| PubChem CID | 163759598 |
| Molecular Formula | C25H22N5O2- |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [(2R)-1-but-2-ynoylazetidin-2-yl]methyl-[5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]azanide |
| SMILES | [H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1cncnc1[N-]C[C@H]1CCN1C(=O)C#CC |
| InChI | InChI=1S/C25H22N5O2/c1-2-6-23(31)30-14-13-19(30)15-28-25-22(16-27-17-29-25)24(26)18-9-11-21(12-10-18)32-20-7-4-3-5-8-20/h3-5,7-12,16-17,19H,13-15H2,1H3,(H-,26,27,28,29)/q-1/t19-/m1/s1 |
| InChIKey | LXBCDYKBIFZMSG-LJQANCHMSA-N |
| XLogP | 4.31 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|