C26H29FN4O2 — CID 145368693
3-[amino-(4-phenoxyphenyl)methyl]-5-fluoro-N-methylpyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 145368693) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 3-[amino-(4-phenoxyphenyl)methyl]-5-fluoro-N-methylpyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | 3-[amino-(4-phenoxyphenyl)methyl]-5-fluoro-N-methylpyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 145368693 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 3-[amino-(4-phenoxyphenyl)methyl]-5-fluoro-N-methylpyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1.CNc1c(F)cncc1C(N)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H18FN3O.C7H11NO/c1-22-19-16(11-23-12-17(19)20)18(21)13-7-9-15(10-8-13)24-14-5-3-2-4-6-14;1-2-7(9)8-5-3-4-6-8/h2-12,18H,21H2,1H3,(H,22,23);2H,1,3-6H2 |
| InChIKey | WNGQEBOAZJIOEC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|