C24H26N4O4 — CID 130432249
3-[4-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]imidazol-1-yl]propanoic acid (PubChem CID 130432249) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 3-[4-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]imidazol-1-yl]propanoic acid.
| Compound Name | 3-[4-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]imidazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 130432249 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 3-[4-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]imidazol-1-yl]propanoic acid |
| SMILES | CN(Cc1cn(CCC(=O)O)cn1)N(C)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H26N4O4/c1-26(13-17-14-28(16-25-17)12-11-23(29)30)27(2)24(31)32-15-22-20-9-5-3-7-18(20)19-8-4-6-10-21(19)22/h3-10,14,16,22H,11-13,15H2,1-2H3,(H,29,30) |
| InChIKey | VXPVQVWSYPMKKQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|