C14H16ClN5O — CID 130433589
(3-chlorophenyl) 4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidate (PubChem CID 130433589) has the molecular formula C14H16ClN5O and a molecular weight of 305.77 g/mol. Its IUPAC name is (3-chlorophenyl) 4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidate.
| Compound Name | (3-chlorophenyl) 4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidate |
|---|---|
| PubChem CID | 130433589 |
| Molecular Formula | C14H16ClN5O |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | (3-chlorophenyl) 4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidate |
| SMILES | [H]/N=C(\Oc1cccc(Cl)c1)c1c(N)ncnc1NC(C)C |
| InChI | InChI=1S/C14H16ClN5O/c1-8(2)20-14-11(12(16)18-7-19-14)13(17)21-10-5-3-4-9(15)6-10/h3-8,17H,1-2H3,(H3,16,18,19,20)/b17-13- |
| InChIKey | IVOVPRYXRPNXFM-LGMDPLHJSA-N |
| XLogP | 2.94 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|