C15H17ClN6O — CID 130434476
(3-chlorophenyl) 4-amino-6-(azetidin-3-ylmethylamino)pyrimidine-5-carboximidate (PubChem CID 130434476) has the molecular formula C15H17ClN6O and a molecular weight of 332.80 g/mol. Its IUPAC name is (3-chlorophenyl) 4-amino-6-(azetidin-3-ylmethylamino)pyrimidine-5-carboximidate.
| Compound Name | (3-chlorophenyl) 4-amino-6-(azetidin-3-ylmethylamino)pyrimidine-5-carboximidate |
|---|---|
| PubChem CID | 130434476 |
| Molecular Formula | C15H17ClN6O |
| Molecular Weight | 332.80 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (3-chlorophenyl) 4-amino-6-(azetidin-3-ylmethylamino)pyrimidine-5-carboximidate |
| SMILES | [H]/N=C(\Oc1cccc(Cl)c1)c1c(N)ncnc1NCC1CNC1 |
| InChI | InChI=1S/C15H17ClN6O/c16-10-2-1-3-11(4-10)23-14(18)12-13(17)21-8-22-15(12)20-7-9-5-19-6-9/h1-4,8-9,18-19H,5-7H2,(H3,17,20,21,22)/b18-14- |
| InChIKey | MPAAUWZEESNQNU-JXAWBTAJSA-N |
| XLogP | 1.75 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.80 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|