C7H10N6O — CID 144810644
ethanimidoyl 4,6-diaminopyrimidine-5-carboximidate (PubChem CID 144810644) has the molecular formula C7H10N6O and a molecular weight of 194.20 g/mol. Its IUPAC name is ethanimidoyl 4,6-diaminopyrimidine-5-carboximidate.
| Compound Name | ethanimidoyl 4,6-diaminopyrimidine-5-carboximidate |
|---|---|
| PubChem CID | 144810644 |
| Molecular Formula | C7H10N6O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | ethanimidoyl 4,6-diaminopyrimidine-5-carboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1c(N)ncnc1N |
| InChI | InChI=1S/C7H10N6O/c1-3(8)14-7(11)4-5(9)12-2-13-6(4)10/h2,8,11H,1H3,(H4,9,10,12,13)/b8-3+,11-7- |
| InChIKey | HAHXUMSESSHCJV-YZXVETGASA-N |
| XLogP | -0.02 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|