C21H18N2O2 — CID 130434169
1-[4-(3,4-diamino-2-methylphenyl)phenyl]-2-phenylethane-1,2-dione (PubChem CID 130434169) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[4-(3,4-diamino-2-methylphenyl)phenyl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[4-(3,4-diamino-2-methylphenyl)phenyl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 130434169 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[4-(3,4-diamino-2-methylphenyl)phenyl]-2-phenylethane-1,2-dione |
| SMILES | Cc1c(-c2ccc(C(=O)C(=O)c3ccccc3)cc2)ccc(N)c1N |
| InChI | InChI=1S/C21H18N2O2/c1-13-17(11-12-18(22)19(13)23)14-7-9-16(10-8-14)21(25)20(24)15-5-3-2-4-6-15/h2-12H,22-23H2,1H3 |
| InChIKey | MDGQPJNPHOCUAE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|