C22H26N2O5 — CID 130439280
[(1S,14S)-9-methoxy-4,16-dimethyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9-trien-14-yl] 1,3-oxazole-5-carboxylate (PubChem CID 130439280) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is [(1S,14S)-9-methoxy-4,16-dimethyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9-trien-14-yl] 1,3-oxazole-5-carboxylate.
| Compound Name | [(1S,14S)-9-methoxy-4,16-dimethyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9-trien-14-yl] 1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 130439280 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [(1S,14S)-9-methoxy-4,16-dimethyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9-trien-14-yl] 1,3-oxazole-5-carboxylate |
| SMILES | COc1ccc2c3c1OC1C[C@@H](OC(=O)c4cnco4)CC(C)[C@@]31CCN(C)C2 |
| InChI | InChI=1S/C22H26N2O5/c1-13-8-15(28-21(25)17-10-23-12-27-17)9-18-22(13)6-7-24(2)11-14-4-5-16(26-3)20(29-18)19(14)22/h4-5,10,12-13,15,18H,6-9,11H2,1-3H3/t13?,15-,18?,22+/m0/s1 |
| InChIKey | SRNZLQAFIOUIKC-HORRMZQXSA-N |
| XLogP | 3.17 |
| TPSA | 74.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |