C23H33NO4 — CID 130438464
[(1S,12S,14S)-9-methoxy-4,17-dimethyl-11-oxa-4-azatetracyclo[8.7.1.01,12.06,18]octadeca-6(18),7,9-trien-14-yl] butanoate (PubChem CID 130438464) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is [(1S,12S,14S)-9-methoxy-4,17-dimethyl-11-oxa-4-azatetracyclo[8.7.1.01,12.06,18]octadeca-6(18),7,9-trien-14-yl] butanoate.
| Compound Name | [(1S,12S,14S)-9-methoxy-4,17-dimethyl-11-oxa-4-azatetracyclo[8.7.1.01,12.06,18]octadeca-6(18),7,9-trien-14-yl] butanoate |
|---|---|
| PubChem CID | 130438464 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | [(1S,12S,14S)-9-methoxy-4,17-dimethyl-11-oxa-4-azatetracyclo[8.7.1.01,12.06,18]octadeca-6(18),7,9-trien-14-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1CCC(C)[C@@]23CCN(C)Cc4ccc(OC)c(c42)O[C@H]3C1 |
| InChI | InChI=1S/C23H33NO4/c1-5-6-20(25)27-17-9-7-15(2)23-11-12-24(3)14-16-8-10-18(26-4)22(21(16)23)28-19(23)13-17/h8,10,15,17,19H,5-7,9,11-14H2,1-4H3/t15?,17-,19-,23+/m0/s1 |
| InChIKey | HUAIPTDWWYVTKS-HSBCNMQSSA-N |
| XLogP | 4.06 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |