C24H27NO4 — CID 70961960
[(1S,14R)-9-methoxy-4,15-dimethyl-11-oxa-4-azatetracyclo[8.5.1.01,12.06,16]hexadeca-6(16),7,9-trien-14-yl] benzoate (PubChem CID 70961960) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is [(1S,14R)-9-methoxy-4,15-dimethyl-11-oxa-4-azatetracyclo[8.5.1.01,12.06,16]hexadeca-6(16),7,9-trien-14-yl] benzoate.
| Compound Name | [(1S,14R)-9-methoxy-4,15-dimethyl-11-oxa-4-azatetracyclo[8.5.1.01,12.06,16]hexadeca-6(16),7,9-trien-14-yl] benzoate |
|---|---|
| PubChem CID | 70961960 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | [(1S,14R)-9-methoxy-4,15-dimethyl-11-oxa-4-azatetracyclo[8.5.1.01,12.06,16]hexadeca-6(16),7,9-trien-14-yl] benzoate |
| SMILES | COc1ccc2c3c1OC1C[C@@H](OC(=O)c4ccccc4)C(C)[C@@]31CCN(C)C2 |
| InChI | InChI=1S/C24H27NO4/c1-15-19(28-23(26)16-7-5-4-6-8-16)13-20-24(15)11-12-25(2)14-17-9-10-18(27-3)22(29-20)21(17)24/h4-10,15,19-20H,11-14H2,1-3H3/t15?,19-,20?,24-/m1/s1 |
| InChIKey | VBYUGFYRFWPVJS-QDLRKIPLSA-N |
| XLogP | 3.79 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |