C61H50N4 — CID 130439965
4-[4-[(6Z,8Z,10E)-4-[4-(2,4-diphenyl-1,2-dihydropyrimidin-6-yl)phenyl]-6,12,12-trimethyl-5H-benzo[10]annulen-7-yl]phenyl]-2,6-diphenylpyrimidine (PubChem CID 130439965) has the molecular formula C61H50N4 and a molecular weight of 839.10 g/mol. Its IUPAC name is 4-[4-[(6Z,8Z,10E)-4-[4-(2,4-diphenyl-1,2-dihydropyrimidin-6-yl)phenyl]-6,12,12-trimethyl-5H-benzo[10]annulen-7-yl]phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[4-[(6Z,8Z,10E)-4-[4-(2,4-diphenyl-1,2-dihydropyrimidin-6-yl)phenyl]-6,12,12-trimethyl-5H-benzo[10]annulen-7-yl]phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 130439965 |
| Molecular Formula | C61H50N4 |
| Molecular Weight | 839.10 g/mol |
| Exact Mass | 838.40 |
| IUPAC Name | 4-[4-[(6Z,8Z,10E)-4-[4-(2,4-diphenyl-1,2-dihydropyrimidin-6-yl)phenyl]-6,12,12-trimethyl-5H-benzo[10]annulen-7-yl]phenyl]-2,6-diphenylpyrimidine |
| SMILES | C/C1=C(c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)\C=C/C=C/C(C)(C)c2cccc(-c3ccc(C4=CC(c5ccccc5)=NC(c5ccccc5)N4)cc3)c2C1 |
| InChI | InChI=1S/C61H50N4/c1-42-39-53-52(44-32-36-48(37-33-44)58-41-56(46-21-10-5-11-22-46)63-60(65-58)50-25-14-7-15-26-50)28-18-29-54(53)61(2,3)38-17-16-27-51(42)43-30-34-47(35-31-43)57-40-55(45-19-8-4-9-20-45)62-59(64-57)49-23-12-6-13-24-49/h4-38,40-41,60,65H,39H2,1-3H3/b27-16-,38-17+,51-42- |
| InChIKey | HPCNXXNXEFELNR-RQZAVANLSA-N |
| XLogP | 14.70 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.10 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |