C52H37N5 — CID 146367432
2-[4-[9-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-3-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,8,11,13-heptaenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 146367432) has the molecular formula C52H37N5 and a molecular weight of 731.90 g/mol. Its IUPAC name is 2-[4-[9-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-3-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,8,11,13-heptaenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[9-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-3-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,8,11,13-heptaenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 146367432 |
| Molecular Formula | C52H37N5 |
| Molecular Weight | 731.90 g/mol |
| Exact Mass | 731.30 |
| IUPAC Name | 2-[4-[9-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-3-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,8,11,13-heptaenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | C1=C(c2ccccc2)NC(C2=Cc3cccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c3-c3ccccc3C2)N=C1c1ccccc1 |
| InChI | InChI=1S/C52H37N5/c1-5-16-36(17-6-1)46-34-47(37-18-7-2-8-19-37)54-52(53-46)43-32-41-24-13-14-26-45(41)48-42(33-43)25-15-27-44(48)35-28-30-40(31-29-35)51-56-49(38-20-9-3-10-21-38)55-50(57-51)39-22-11-4-12-23-39/h1-31,33-34,52-53H,32H2 |
| InChIKey | AMUMKDLRPGPSIZ-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.90 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |