C16H22N2O2 — CID 130441937
1,1-dimethyl-3-[(Z)-3-oxoprop-1-enyl]-3-(4-phenylbutyl)urea (PubChem CID 130441937) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(Z)-3-oxoprop-1-enyl]-3-(4-phenylbutyl)urea.
| Compound Name | 1,1-dimethyl-3-[(Z)-3-oxoprop-1-enyl]-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 130441937 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1,1-dimethyl-3-[(Z)-3-oxoprop-1-enyl]-3-(4-phenylbutyl)urea |
| SMILES | CN(C)C(=O)N(/C=C\C=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C16H22N2O2/c1-17(2)16(20)18(13-8-14-19)12-7-6-11-15-9-4-3-5-10-15/h3-5,8-10,13-14H,6-7,11-12H2,1-2H3/b13-8- |
| InChIKey | HCGWTRSWOYHDEG-JYRVWZFOSA-N |
| XLogP | 2.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|