C29H36F3N5O2 — CID 130449450
2-N-tert-butyl-8-N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide (PubChem CID 130449450) has the molecular formula C29H36F3N5O2 and a molecular weight of 543.63 g/mol. Its IUPAC name is 2-N-tert-butyl-8-N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide.
| Compound Name | 2-N-tert-butyl-8-N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide |
|---|---|
| PubChem CID | 130449450 |
| Molecular Formula | C29H36F3N5O2 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 2-N-tert-butyl-8-N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide |
| SMILES | Cc1cc(C)n(CCNC(=O)C2C=CC(c3cccc(C(F)(F)F)c3)=C3CCN(C(=O)NC(C)(C)C)CC32)n1 |
| InChI | InChI=1S/C29H36F3N5O2/c1-18-15-19(2)37(35-18)14-12-33-26(38)24-10-9-22(20-7-6-8-21(16-20)29(30,31)32)23-11-13-36(17-25(23)24)27(39)34-28(3,4)5/h6-10,15-16,24-25H,11-14,17H2,1-5H3,(H,33,38)(H,34,39) |
| InChIKey | MOBSOLWKPKACJI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |