C28H33F3N4O2S — CID 130449455
2-N-tert-butyl-8-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide (PubChem CID 130449455) has the molecular formula C28H33F3N4O2S and a molecular weight of 546.66 g/mol. Its IUPAC name is 2-N-tert-butyl-8-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide.
| Compound Name | 2-N-tert-butyl-8-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide |
|---|---|
| PubChem CID | 130449455 |
| Molecular Formula | C28H33F3N4O2S |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 2-N-tert-butyl-8-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide |
| SMILES | Cc1nc(C)c(CNC(=O)C2C=CC(c3cccc(C(F)(F)F)c3)=C3CCN(C(=O)NC(C)(C)C)CC32)s1 |
| InChI | InChI=1S/C28H33F3N4O2S/c1-16-24(38-17(2)33-16)14-32-25(36)22-10-9-20(18-7-6-8-19(13-18)28(29,30)31)21-11-12-35(15-23(21)22)26(37)34-27(3,4)5/h6-10,13,22-23H,11-12,14-15H2,1-5H3,(H,32,36)(H,34,37) |
| InChIKey | RQTAMUPSFFBLPW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |