C24H26F3N5O2S — CID 130437276
(3R,4R)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-ethyl-3-hydroxy-4-methyl-7-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 130437276) has the molecular formula C24H26F3N5O2S and a molecular weight of 505.57 g/mol. Its IUPAC name is (3R,4R)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-ethyl-3-hydroxy-4-methyl-7-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | (3R,4R)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-ethyl-3-hydroxy-4-methyl-7-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 130437276 |
| Molecular Formula | C24H26F3N5O2S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | (3R,4R)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-ethyl-3-hydroxy-4-methyl-7-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | CCN1C[C@@H](O)[C@@H](C)N(C(=O)Nc2nc(C)c(C)s2)c2nc(-c3cccc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C24H26F3N5O2S/c1-5-31-12-20(33)14(3)32(23(34)30-22-28-13(2)15(4)35-22)21-19(31)10-9-18(29-21)16-7-6-8-17(11-16)24(25,26)27/h6-11,14,20,33H,5,12H2,1-4H3,(H,28,30,34)/t14-,20-/m1/s1 |
| InChIKey | ZRFMJABJTYKWEU-JLTOFOAXSA-N |
| XLogP | 5.47 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |