C31H30F3N7O3 — CID 137198198
2-N-[4-(1H-benzimidazol-2-yl)-1,2,5-oxadiazol-3-yl]-2-N-tert-butyl-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide (PubChem CID 137198198) has the molecular formula C31H30F3N7O3 and a molecular weight of 605.62 g/mol. Its IUPAC name is 2-N-[4-(1H-benzimidazol-2-yl)-1,2,5-oxadiazol-3-yl]-2-N-tert-butyl-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide.
| Compound Name | 2-N-[4-(1H-benzimidazol-2-yl)-1,2,5-oxadiazol-3-yl]-2-N-tert-butyl-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide |
|---|---|
| PubChem CID | 137198198 |
| Molecular Formula | C31H30F3N7O3 |
| Molecular Weight | 605.62 g/mol |
| Exact Mass | 605.24 |
| IUPAC Name | 2-N-[4-(1H-benzimidazol-2-yl)-1,2,5-oxadiazol-3-yl]-2-N-tert-butyl-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide |
| SMILES | CC(C)(C)N(C(=O)N1CCC2=C(c3cccc(C(F)(F)F)c3)C=CC(C(N)=O)C2C1)c1nonc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C31H30F3N7O3/c1-30(2,3)41(28-25(38-44-39-28)27-36-23-9-4-5-10-24(23)37-27)29(43)40-14-13-20-19(11-12-21(26(35)42)22(20)16-40)17-7-6-8-18(15-17)31(32,33)34/h4-12,15,21-22H,13-14,16H2,1-3H3,(H2,35,42)(H,36,37) |
| InChIKey | CDLUTJSIIKQQMU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |