C34H36F3N3O6 — CID 130449509
1-[[4-[2-methoxy-5-[3-(trifluoromethyl)phenyl]phenyl]-2-pyridinyl]methyl]-3-(10,11,12,13-tetraoxotridecyl)urea (PubChem CID 130449509) has the molecular formula C34H36F3N3O6 and a molecular weight of 639.67 g/mol. Its IUPAC name is 1-[[4-[2-methoxy-5-[3-(trifluoromethyl)phenyl]phenyl]-2-pyridinyl]methyl]-3-(10,11,12,13-tetraoxotridecyl)urea.
| Compound Name | 1-[[4-[2-methoxy-5-[3-(trifluoromethyl)phenyl]phenyl]-2-pyridinyl]methyl]-3-(10,11,12,13-tetraoxotridecyl)urea |
|---|---|
| PubChem CID | 130449509 |
| Molecular Formula | C34H36F3N3O6 |
| Molecular Weight | 639.67 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | 1-[[4-[2-methoxy-5-[3-(trifluoromethyl)phenyl]phenyl]-2-pyridinyl]methyl]-3-(10,11,12,13-tetraoxotridecyl)urea |
| SMILES | COc1ccc(-c2cccc(C(F)(F)F)c2)cc1-c1ccnc(CNC(=O)NCCCCCCCCCC(=O)C(=O)C(=O)C=O)c1 |
| InChI | InChI=1S/C34H36F3N3O6/c1-46-31-14-13-24(23-10-9-11-26(18-23)34(35,36)37)20-28(31)25-15-17-38-27(19-25)21-40-33(45)39-16-8-6-4-2-3-5-7-12-29(42)32(44)30(43)22-41/h9-11,13-15,17-20,22H,2-8,12,16,21H2,1H3,(H2,39,40,45) |
| InChIKey | DBEUEACMDBGQKI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.67 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|