C25H34N4O2 — CID 130451387
N,N-dimethyl-4-(2-phenylmethoxy-5-piperidin-1-ylphenyl)piperazine-1-carboxamide (PubChem CID 130451387) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-phenylmethoxy-5-piperidin-1-ylphenyl)piperazine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-(2-phenylmethoxy-5-piperidin-1-ylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 130451387 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | N,N-dimethyl-4-(2-phenylmethoxy-5-piperidin-1-ylphenyl)piperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(c2cc(N3CCCCC3)ccc2OCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H34N4O2/c1-26(2)25(30)29-17-15-28(16-18-29)23-19-22(27-13-7-4-8-14-27)11-12-24(23)31-20-21-9-5-3-6-10-21/h3,5-6,9-12,19H,4,7-8,13-18,20H2,1-2H3 |
| InChIKey | XYTDBMXDOAAPMG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|