C23H14ClN3 — CID 130452678
4-[3-(2-chloro-6-phenylpyrimidin-4-yl)phenyl]benzonitrile (PubChem CID 130452678) has the molecular formula C23H14ClN3 and a molecular weight of 367.84 g/mol. Its IUPAC name is 4-[3-(2-chloro-6-phenylpyrimidin-4-yl)phenyl]benzonitrile.
| Compound Name | 4-[3-(2-chloro-6-phenylpyrimidin-4-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 130452678 |
| Molecular Formula | C23H14ClN3 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-[3-(2-chloro-6-phenylpyrimidin-4-yl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cccc(-c3cc(-c4ccccc4)nc(Cl)n3)c2)cc1 |
| InChI | InChI=1S/C23H14ClN3/c24-23-26-21(18-5-2-1-3-6-18)14-22(27-23)20-8-4-7-19(13-20)17-11-9-16(15-25)10-12-17/h1-14H |
| InChIKey | DKRQTKFDDBTONP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |