C23H25NO7 — CID 130455372
7-[3-methyl-4-[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxyphenyl]-2H-isoquinolin-1-one (PubChem CID 130455372) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is 7-[3-methyl-4-[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxyphenyl]-2H-isoquinolin-1-one.
| Compound Name | 7-[3-methyl-4-[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxyphenyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 130455372 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 7-[3-methyl-4-[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxyphenyl]-2H-isoquinolin-1-one |
| SMILES | Cc1cc(-c2ccc3cc[nH]c(=O)c3c2)ccc1O[C@H]1O[C@H](CO)[C@@H](O)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C23H25NO7/c1-12-9-14(15-4-3-13-7-8-24-21(28)16(13)10-15)5-6-17(12)30-22-20(27)23(2,29)19(26)18(11-25)31-22/h3-10,18-20,22,25-27,29H,11H2,1-2H3,(H,24,28)/t18-,19-,20-,22+,23+/m1/s1 |
| InChIKey | ZSYWGYZFHBXZFZ-UJNULRONSA-N |
| XLogP | 1.07 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |