C32H20F2N4 — CID 130459802
[6-cyanoimino-2-(3,4-difluorophenyl)-10a-methyl-8-prop-1-en-2-yl-6aH-indeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 130459802) has the molecular formula C32H20F2N4 and a molecular weight of 498.54 g/mol. Its IUPAC name is [6-cyanoimino-2-(3,4-difluorophenyl)-10a-methyl-8-prop-1-en-2-yl-6aH-indeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [6-cyanoimino-2-(3,4-difluorophenyl)-10a-methyl-8-prop-1-en-2-yl-6aH-indeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 130459802 |
| Molecular Formula | C32H20F2N4 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | [6-cyanoimino-2-(3,4-difluorophenyl)-10a-methyl-8-prop-1-en-2-yl-6aH-indeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | C=C(C)C1=CC2/C(=N\C#N)c3cc4c(cc3C2(C)C=C1)/C(=N/C#N)c1cc(-c2ccc(F)c(F)c2)ccc1-4 |
| InChI | InChI=1S/C32H20F2N4/c1-17(2)18-8-9-32(3)26-14-24-22(13-25(26)31(38-16-36)27(32)11-18)21-6-4-19(10-23(21)30(24)37-15-35)20-5-7-28(33)29(34)12-20/h4-14,27H,1H2,2-3H3/b37-30+,38-31- |
| InChIKey | IGTXQYPCCDRHIN-ZBEDZSNTSA-N |
| XLogP | 7.16 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|