C22H33N2O3P — CID 130461867
2-phenyl-N-(phosphanyloxymethyl)-N-(7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl)acetamide (PubChem CID 130461867) has the molecular formula C22H33N2O3P and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-phenyl-N-(phosphanyloxymethyl)-N-(7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl)acetamide.
| Compound Name | 2-phenyl-N-(phosphanyloxymethyl)-N-(7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl)acetamide |
|---|---|
| PubChem CID | 130461867 |
| Molecular Formula | C22H33N2O3P |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-phenyl-N-(phosphanyloxymethyl)-N-(7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl)acetamide |
| SMILES | O=C(Cc1ccccc1)N(COP)C1CCC2(CCCO2)CC1N1CCCC1 |
| InChI | InChI=1S/C22H33N2O3P/c25-21(15-18-7-2-1-3-8-18)24(17-27-28)19-9-11-22(10-6-14-26-22)16-20(19)23-12-4-5-13-23/h1-3,7-8,19-20H,4-6,9-17,28H2 |
| InChIKey | WSADWQXSJGDOHW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|