C12H16N2O2 — CID 13046612
2-(3,3-dipropoxyprop-2-enylidene)propanedinitrile (PubChem CID 13046612) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-(3,3-dipropoxyprop-2-enylidene)propanedinitrile.
| Compound Name | 2-(3,3-dipropoxyprop-2-enylidene)propanedinitrile |
|---|---|
| PubChem CID | 13046612 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-(3,3-dipropoxyprop-2-enylidene)propanedinitrile |
| SMILES | CCCOC(=CC=C(C#N)C#N)OCCC |
| InChI | InChI=1S/C12H16N2O2/c1-3-7-15-12(16-8-4-2)6-5-11(9-13)10-14/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | ZSQROGYRHYAQRU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|