C9H9N3 — CID 173359820
2-(3-aminohexa-2,5-dienylidene)propanedinitrile (PubChem CID 173359820) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-(3-aminohexa-2,5-dienylidene)propanedinitrile.
| Compound Name | 2-(3-aminohexa-2,5-dienylidene)propanedinitrile |
|---|---|
| PubChem CID | 173359820 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 2-(3-aminohexa-2,5-dienylidene)propanedinitrile |
| SMILES | C=CCC(N)=CC=C(C#N)C#N |
| InChI | InChI=1S/C9H9N3/c1-2-3-9(12)5-4-8(6-10)7-11/h2,4-5H,1,3,12H2 |
| InChIKey | SRNIWSGXQZTVAH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|