C12H17F2N — CID 162606381
(4E,6Z)-9,9-difluoro-8-methylideneundeca-1,4,6-trien-4-amine (PubChem CID 162606381) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is (4E,6Z)-9,9-difluoro-8-methylideneundeca-1,4,6-trien-4-amine.
| Compound Name | (4E,6Z)-9,9-difluoro-8-methylideneundeca-1,4,6-trien-4-amine |
|---|---|
| PubChem CID | 162606381 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | (4E,6Z)-9,9-difluoro-8-methylideneundeca-1,4,6-trien-4-amine |
| SMILES | C=CC/C(N)=C\C=C/C(=C)C(F)(F)CC |
| InChI | InChI=1S/C12H17F2N/c1-4-7-11(15)9-6-8-10(3)12(13,14)5-2/h4,6,8-9H,1,3,5,7,15H2,2H3/b8-6-,11-9+ |
| InChIKey | CMTZLMJBGNEONP-ZOEDNYEGSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|