C8H13NO2 — CID 88554875
(2Z,4Z)-2-amino-6-methylidenehepta-2,4-diene-1,7-diol (PubChem CID 88554875) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (2Z,4Z)-2-amino-6-methylidenehepta-2,4-diene-1,7-diol.
| Compound Name | (2Z,4Z)-2-amino-6-methylidenehepta-2,4-diene-1,7-diol |
|---|---|
| PubChem CID | 88554875 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (2Z,4Z)-2-amino-6-methylidenehepta-2,4-diene-1,7-diol |
| SMILES | C=C(/C=C\C=C(/N)CO)CO |
| InChI | InChI=1S/C8H13NO2/c1-7(5-10)3-2-4-8(9)6-11/h2-4,10-11H,1,5-6,9H2/b3-2-,8-4- |
| InChIKey | NCGDLZDWIHKFDM-BGRWSDHPSA-N |
| XLogP | -0.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|