C4H9NO2 — CID 58594730
(Z)-2-aminobut-2-ene-1,4-diol (PubChem CID 58594730) has the molecular formula C4H9NO2 and a molecular weight of 103.12 g/mol. Its IUPAC name is (Z)-2-aminobut-2-ene-1,4-diol.
| Compound Name | (Z)-2-aminobut-2-ene-1,4-diol |
|---|---|
| PubChem CID | 58594730 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | (Z)-2-aminobut-2-ene-1,4-diol |
| SMILES | N/C(=C\CO)CO |
| InChI | InChI=1S/C4H9NO2/c5-4(3-7)1-2-6/h1,6-7H,2-3,5H2/b4-1- |
| InChIKey | RUDWIXVUEDGRBB-RJRFIUFISA-N |
| XLogP | -1.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |