C11H15N — CID 176519196
(3Z)-7-methyldeca-1,3,5,6,9-pentaen-2-amine (PubChem CID 176519196) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (3Z)-7-methyldeca-1,3,5,6,9-pentaen-2-amine.
| Compound Name | (3Z)-7-methyldeca-1,3,5,6,9-pentaen-2-amine |
|---|---|
| PubChem CID | 176519196 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (3Z)-7-methyldeca-1,3,5,6,9-pentaen-2-amine |
| SMILES | C=CCC(C)=C=C/C=C\C(=C)N |
| InChI | InChI=1S/C11H15N/c1-4-7-10(2)8-5-6-9-11(3)12/h4-6,9H,1,3,7,12H2,2H3/b9-6- |
| InChIKey | BQKDYQLUQQLYDI-TWGQIWQCSA-N |
| XLogP | 2.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|