C10H13FN2O7PS+ — CID 130469164
[(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-2-(hydroxymethyl)-2-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium (PubChem CID 130469164) has the molecular formula C10H13FN2O7PS+ and a molecular weight of 355.26 g/mol. Its IUPAC name is [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-2-(hydroxymethyl)-2-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium.
| Compound Name | [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-2-(hydroxymethyl)-2-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium |
|---|---|
| PubChem CID | 130469164 |
| Molecular Formula | C10H13FN2O7PS+ |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-2-(hydroxymethyl)-2-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium |
| SMILES | CO[C@]1(CO)O[C@@H](n2ccc(=O)[nH]c2=O)C(F)C1O[P+](=O)S |
| InChI | InChI=1S/C10H12FN2O7PS/c1-18-10(4-14)7(20-21(17)22)6(11)8(19-10)13-3-2-5(15)12-9(13)16/h2-3,6-8,14H,4H2,1H3,(H-,12,15,16,17,22)/p+1/t6?,7?,8-,10-/m1/s1 |
| InChIKey | KCQHGCPMRNNDFH-CJXRSZHYSA-O |
| XLogP | -0.29 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|