C13H16N2O10PS+ — CID 54592082
[(3R,4R,5R)-2-(2,2-dicarboxyethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium (PubChem CID 54592082) has the molecular formula C13H16N2O10PS+ and a molecular weight of 423.32 g/mol. Its IUPAC name is [(3R,4R,5R)-2-(2,2-dicarboxyethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium.
| Compound Name | [(3R,4R,5R)-2-(2,2-dicarboxyethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium |
|---|---|
| PubChem CID | 54592082 |
| Molecular Formula | C13H16N2O10PS+ |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | [(3R,4R,5R)-2-(2,2-dicarboxyethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium |
| SMILES | CO[C@@H]1[C@H](O[P+](=O)S)C(CC(C(=O)O)C(=O)O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C13H15N2O10PS/c1-23-9-8(25-26(22)27)6(4-5(11(17)18)12(19)20)24-10(9)15-3-2-7(16)14-13(15)21/h2-3,5-6,8-10H,4H2,1H3,(H3-,14,16,17,18,19,20,21,22,27)/p+1/t6?,8-,9-,10-/m1/s1 |
| InChIKey | WNIUXTZGTWKDIJ-JPMHVPNBSA-O |
| XLogP | -0.40 |
| TPSA | 174.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|