C13H18N2O9PS+ — CID 123326675
[2-(2,2-dicarboxyethyl)-4-methoxy-5-(6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-3-yl]oxy-oxo-sulfanylphosphanium (PubChem CID 123326675) has the molecular formula C13H18N2O9PS+ and a molecular weight of 409.33 g/mol. Its IUPAC name is [2-(2,2-dicarboxyethyl)-4-methoxy-5-(6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-3-yl]oxy-oxo-sulfanylphosphanium.
| Compound Name | [2-(2,2-dicarboxyethyl)-4-methoxy-5-(6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-3-yl]oxy-oxo-sulfanylphosphanium |
|---|---|
| PubChem CID | 123326675 |
| Molecular Formula | C13H18N2O9PS+ |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | [2-(2,2-dicarboxyethyl)-4-methoxy-5-(6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-3-yl]oxy-oxo-sulfanylphosphanium |
| SMILES | COC1C(O[P+](=O)S)C(CC(C(=O)O)C(=O)O)OC1N1C=CC(=O)NC1 |
| InChI | InChI=1S/C13H17N2O9PS/c1-22-10-9(24-25(21)26)7(4-6(12(17)18)13(19)20)23-11(10)15-3-2-8(16)14-5-15/h2-3,6-7,9-11H,4-5H2,1H3,(H3-,14,16,17,18,19,20,21,26)/p+1 |
| InChIKey | NCYANEBFYYNSTH-UHFFFAOYSA-O |
| XLogP | -0.22 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|