C17H26N3O13P2S+ — CID 123428882
[2-[[(3,3-dicarboxypropylamino)-hydroxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium (PubChem CID 123428882) has the molecular formula C17H26N3O13P2S+ and a molecular weight of 574.42 g/mol. Its IUPAC name is [2-[[(3,3-dicarboxypropylamino)-hydroxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium.
| Compound Name | [2-[[(3,3-dicarboxypropylamino)-hydroxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium |
|---|---|
| PubChem CID | 123428882 |
| Molecular Formula | C17H26N3O13P2S+ |
| Molecular Weight | 574.42 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | [2-[[(3,3-dicarboxypropylamino)-hydroxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium |
| SMILES | CCC1(COP(=O)(O)NCCC(C(=O)O)C(=O)O)OC(n2ccc(=O)[nH]c2=O)C(OC)C1O[P+](=O)S |
| InChI | InChI=1S/C17H25N3O13P2S/c1-3-17(8-31-35(28,29)18-6-4-9(14(22)23)15(24)25)12(33-34(27)36)11(30-2)13(32-17)20-7-5-10(21)19-16(20)26/h5,7,9,11-13H,3-4,6,8H2,1-2H3,(H5-,18,19,21,22,23,24,25,26,27,28,29,36)/p+1 |
| InChIKey | PMGDXJATBLKPER-UHFFFAOYSA-O |
| XLogP | 0.08 |
| TPSA | 232.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.42 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|