C18H28N3O6P — CID 174100754
3-[[(2S,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-methoxy-2-propyloxolan-3-yl]oxy-methylphosphanyl]oxypropanenitrile (PubChem CID 174100754) has the molecular formula C18H28N3O6P and a molecular weight of 413.41 g/mol. Its IUPAC name is 3-[[(2S,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-methoxy-2-propyloxolan-3-yl]oxy-methylphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2S,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-methoxy-2-propyloxolan-3-yl]oxy-methylphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 174100754 |
| Molecular Formula | C18H28N3O6P |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 3-[[(2S,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-methoxy-2-propyloxolan-3-yl]oxy-methylphosphanyl]oxypropanenitrile |
| SMILES | CCC[C@]1(CC)O[C@@H](n2ccc(=O)[nH]c2=O)C(OC)[C@H]1OP(C)OCCC#N |
| InChI | InChI=1S/C18H28N3O6P/c1-5-9-18(6-2)15(27-28(4)25-12-7-10-19)14(24-3)16(26-18)21-11-8-13(22)20-17(21)23/h8,11,14-16H,5-7,9,12H2,1-4H3,(H,20,22,23)/t14?,15-,16-,18+,28?/m1/s1 |
| InChIKey | NCSSUVRINTVRDF-SYPNUTEASA-N |
| XLogP | 2.29 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|