C25H42N2O7Si — CID 163641020
[(2S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-2-propyloxolan-3-yl] 4-oxohexanoate (PubChem CID 163641020) has the molecular formula C25H42N2O7Si and a molecular weight of 510.70 g/mol. Its IUPAC name is [(2S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-2-propyloxolan-3-yl] 4-oxohexanoate.
| Compound Name | [(2S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-2-propyloxolan-3-yl] 4-oxohexanoate |
|---|---|
| PubChem CID | 163641020 |
| Molecular Formula | C25H42N2O7Si |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | [(2S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-2-propyloxolan-3-yl] 4-oxohexanoate |
| SMILES | CCC[C@]1(CC)O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](O[Si](C)(C)C(C)(C)C)C1OC(=O)CCC(=O)CC |
| InChI | InChI=1S/C25H42N2O7Si/c1-9-15-25(11-3)21(32-19(30)13-12-17(28)10-2)20(34-35(7,8)24(4,5)6)22(33-25)27-16-14-18(29)26-23(27)31/h14,16,20-22H,9-13,15H2,1-8H3,(H,26,29,31)/t20-,21?,22+,25-/m0/s1 |
| InChIKey | LHESUWTWBYKGOZ-XTMJHDMTSA-N |
| XLogP | 4.08 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|