C15H21IN3O6P — CID 165030640
3-[[(2R,3S,5R)-2-ethyl-5-(5-iodo-2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-3-yl]oxy-methylphosphanyl]oxypropanenitrile (PubChem CID 165030640) has the molecular formula C15H21IN3O6P and a molecular weight of 497.23 g/mol. Its IUPAC name is 3-[[(2R,3S,5R)-2-ethyl-5-(5-iodo-2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-3-yl]oxy-methylphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,3S,5R)-2-ethyl-5-(5-iodo-2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-3-yl]oxy-methylphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 165030640 |
| Molecular Formula | C15H21IN3O6P |
| Molecular Weight | 497.23 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | 3-[[(2R,3S,5R)-2-ethyl-5-(5-iodo-2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-3-yl]oxy-methylphosphanyl]oxypropanenitrile |
| SMILES | CC[C@H]1O[C@@H](n2cc(I)c(=O)[nH]c2=O)C(OC)[C@H]1OP(C)OCCC#N |
| InChI | InChI=1S/C15H21IN3O6P/c1-4-10-11(25-26(3)23-7-5-6-17)12(22-2)14(24-10)19-8-9(16)13(20)18-15(19)21/h8,10-12,14H,4-5,7H2,1-3H3,(H,18,20,21)/t10-,11+,12?,14-,26?/m1/s1 |
| InChIKey | MUEMRWMQODHXTR-RGVDRNQPSA-N |
| XLogP | 1.72 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|