C15H22N3O9P2S2+ — CID 130316544
[(2R,4S,5R)-3-[2-cyanoethoxy(methoxy)phosphinothioyl]oxy-4-methoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-sulfanylphosphanium (PubChem CID 130316544) has the molecular formula C15H22N3O9P2S2+ and a molecular weight of 514.44 g/mol. Its IUPAC name is [(2R,4S,5R)-3-[2-cyanoethoxy(methoxy)phosphinothioyl]oxy-4-methoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-sulfanylphosphanium.
| Compound Name | [(2R,4S,5R)-3-[2-cyanoethoxy(methoxy)phosphinothioyl]oxy-4-methoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-sulfanylphosphanium |
|---|---|
| PubChem CID | 130316544 |
| Molecular Formula | C15H22N3O9P2S2+ |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | [(2R,4S,5R)-3-[2-cyanoethoxy(methoxy)phosphinothioyl]oxy-4-methoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-sulfanylphosphanium |
| SMILES | CO[C@H]1C(OP(=S)(OC)OCCC#N)[C@@H](CO[P+](=O)S)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H21N3O9P2S2/c1-9-7-18(15(20)17-13(9)19)14-12(22-2)11(10(26-14)8-24-28(21)30)27-29(31,23-3)25-6-4-5-16/h7,10-12,14H,4,6,8H2,1-3H3,(H-,17,19,20,21,30)/p+1/t10-,11?,12+,14-,29?/m1/s1 |
| InChIKey | WFLIYZZQGHZZLL-MQXQRDKASA-O |
| XLogP | 1.55 |
| TPSA | 151.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|