C15H18N4O7P+ — CID 177499872
amino-[[(2R,3R,4R,5R)-4-(2-cyanoethoxy)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy]-oxophosphanium (PubChem CID 177499872) has the molecular formula C15H18N4O7P+ and a molecular weight of 397.30 g/mol. Its IUPAC name is amino-[[(2R,3R,4R,5R)-4-(2-cyanoethoxy)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy]-oxophosphanium.
| Compound Name | amino-[[(2R,3R,4R,5R)-4-(2-cyanoethoxy)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 177499872 |
| Molecular Formula | C15H18N4O7P+ |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | amino-[[(2R,3R,4R,5R)-4-(2-cyanoethoxy)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy]-oxophosphanium |
| SMILES | CC#Cc1cn([C@@H]2O[C@H](CO[P+](N)=O)[C@@H](O)[C@H]2OCCC#N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H17N4O7P/c1-2-4-9-7-19(15(22)18-13(9)21)14-12(24-6-3-5-16)11(20)10(26-14)8-25-27(17)23/h7,10-12,14,20H,3,6,8H2,1H3,(H2-,17,18,21,22,23)/p+1/t10-,11-,12-,14-/m1/s1 |
| InChIKey | LWKSHYDGBAKJGM-HKUMRIAESA-O |
| XLogP | -0.90 |
| TPSA | 169.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|