C18H21O3P — CID 130476140
(3-ethylphenyl)-(2,3,4-trimethylphenyl)methanone;phosphenous acid (PubChem CID 130476140) has the molecular formula C18H21O3P and a molecular weight of 316.34 g/mol. Its IUPAC name is (3-ethylphenyl)-(2,3,4-trimethylphenyl)methanone;phosphenous acid.
| Compound Name | (3-ethylphenyl)-(2,3,4-trimethylphenyl)methanone;phosphenous acid |
|---|---|
| PubChem CID | 130476140 |
| Molecular Formula | C18H21O3P |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (3-ethylphenyl)-(2,3,4-trimethylphenyl)methanone;phosphenous acid |
| SMILES | CCc1cccc(C(=O)c2ccc(C)c(C)c2C)c1.O=PO |
| InChI | InChI=1S/C18H20O.HO2P/c1-5-15-7-6-8-16(11-15)18(19)17-10-9-12(2)13(3)14(17)4;1-3-2/h6-11H,5H2,1-4H3;(H,1,2) |
| InChIKey | PRWIVYHJGKNFLW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|