C10H18FNO2 — CID 130478131
N-(2-fluoroethyl)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 130478131) has the molecular formula C10H18FNO2 and a molecular weight of 203.26 g/mol. Its IUPAC name is N-(2-fluoroethyl)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-(2-fluoroethyl)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 130478131 |
| Molecular Formula | C10H18FNO2 |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-(2-fluoroethyl)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | FCCNC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C10H18FNO2/c11-5-6-12-9-1-3-10(4-2-9)13-7-8-14-10/h9,12H,1-8H2 |
| InChIKey | GJUVUDQBEDIFKD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |